C32H60N6O8 — CID 56773553
bis(tert-butyl 4-(piperidin-3-ylmethyl)piperazine-1-carboxylate);oxalic acid (PubChem CID 56773553) has the molecular formula C32H60N6O8 and a molecular weight of 656.87 g/mol. Its IUPAC name is bis(tert-butyl 4-(piperidin-3-ylmethyl)piperazine-1-carboxylate);oxalic acid.
| Compound Name | bis(tert-butyl 4-(piperidin-3-ylmethyl)piperazine-1-carboxylate);oxalic acid |
|---|---|
| PubChem CID | 56773553 |
| Molecular Formula | C32H60N6O8 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.45 |
| IUPAC Name | bis(tert-butyl 4-(piperidin-3-ylmethyl)piperazine-1-carboxylate);oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC2CCCNC2)CC1.CC(C)(C)OC(=O)N1CCN(CC2CCCNC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C15H29N3O2.C2H2O4/c2*1-15(2,3)20-14(19)18-9-7-17(8-10-18)12-13-5-4-6-16-11-13;3-1(4)2(5)6/h2*13,16H,4-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | RLBCEYIQRJTURE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|