C21H30F3N3O3 — CID 23081198
tert-butyl 4-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 23081198) has the molecular formula C21H30F3N3O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23081198 |
| Molecular Formula | C21H30F3N3O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | tert-butyl 4-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CCN(c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H30F3N3O3/c1-20(2,3)30-19(28)27-14-12-26(13-15-27)17-8-10-25(11-9-17)16-4-6-18(7-5-16)29-21(22,23)24/h4-7,17H,8-15H2,1-3H3 |
| InChIKey | QFXOROZFPCZTHT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|