C17H23F3N2O3 — CID 68847847
tert-butyl 4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carboxylate (PubChem CID 68847847) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is tert-butyl 4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68847847 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | tert-butyl 4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(OCC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-16(2,3)25-15(23)22-10-8-21(9-11-22)13-4-6-14(7-5-13)24-12-17(18,19)20/h4-7H,8-12H2,1-3H3 |
| InChIKey | PASDPHMQPAJYAJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|