C13H15F3N2O2 — CID 143766600
4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbaldehyde (PubChem CID 143766600) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 143766600 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2ccc(OCC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C13H15F3N2O2/c14-13(15,16)9-20-12-3-1-11(2-4-12)18-7-5-17(10-19)6-8-18/h1-4,10H,5-9H2 |
| InChIKey | GZSTZUHOVYJVKT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|