C14H16F6O2 — CID 143388365
acetylene;1,4-bis(2,2,2-trifluoroethoxy)benzene;ethane (PubChem CID 143388365) has the molecular formula C14H16F6O2 and a molecular weight of 330.27 g/mol. Its IUPAC name is acetylene;1,4-bis(2,2,2-trifluoroethoxy)benzene;ethane.
| Compound Name | acetylene;1,4-bis(2,2,2-trifluoroethoxy)benzene;ethane |
|---|---|
| PubChem CID | 143388365 |
| Molecular Formula | C14H16F6O2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | acetylene;1,4-bis(2,2,2-trifluoroethoxy)benzene;ethane |
| SMILES | C#C.CC.FC(F)(F)COc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F6O2.C2H6.C2H2/c11-9(12,13)5-17-7-1-2-8(4-3-7)18-6-10(14,15)16;2*1-2/h1-4H,5-6H2;1-2H3;1-2H |
| InChIKey | MNBAOOPQGOPRAC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|