About 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol
4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol (PubChem CID 136880814) has the molecular formula C14H11F3N2O2
and a molecular weight of 296.25 g/mol. Its IUPAC name is 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol.
Molecular Properties
| Compound Name | 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol |
| PubChem CID | 136880814 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol |
| SMILES | Oc1ccc(/N=N/c2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H11F3N2O2/c15-14(16,17)9-21-13-7-3-11(4-8-13)19-18-10-1-5-12(20)6-2-10/h1-8,20H,9H2/b19-18+ |
| InChIKey | QSVFQWADMVLIJA-VHEBQXMUSA-N |
| XLogP | 4.75 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol?
The IUPAC name of 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol (CID 136880814) is 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol.
What is the SMILES notation for 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol?
The canonical SMILES for 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol is Oc1ccc(/N=N/c2ccc(OCC(F)(F)F)cc2)cc1.
What is the InChIKey of 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol?
The InChIKey is QSVFQWADMVLIJA-VHEBQXMUSA-N. The full InChI is InChI=1S/C14H11F3N2O2/c15-14(16,17)9-21-13-7-3-11(4-8-13)19-18-10-1-5-12(20)6-2-10/h1-8,20H,9H2/b19-18+.
What are the key properties of 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol?
4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol has a molecular weight of 296.25 g/mol, XLogP of 4.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,2,2-trifluoroethoxy)phenyl]diazenyl]phenol is sourced from PubChem (CID 136880814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).