C12H15F3N2O — CID 86685401
N'-[4-(2,2,2-trifluoroethoxy)phenyl]butanimidamide (PubChem CID 86685401) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N'-[4-(2,2,2-trifluoroethoxy)phenyl]butanimidamide.
| Compound Name | N'-[4-(2,2,2-trifluoroethoxy)phenyl]butanimidamide |
|---|---|
| PubChem CID | 86685401 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N'-[4-(2,2,2-trifluoroethoxy)phenyl]butanimidamide |
| SMILES | CCC/C(N)=N\c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O/c1-2-3-11(16)17-9-4-6-10(7-5-9)18-8-12(13,14)15/h4-7H,2-3,8H2,1H3,(H2,16,17) |
| InChIKey | SUYPYDKUKPZWMN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|