C10H7Br2F3O — CID 142613990
1-(2,2-dibromoethenyl)-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 142613990) has the molecular formula C10H7Br2F3O and a molecular weight of 359.97 g/mol. Its IUPAC name is 1-(2,2-dibromoethenyl)-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-(2,2-dibromoethenyl)-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 142613990 |
| Molecular Formula | C10H7Br2F3O |
| Molecular Weight | 359.97 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | 1-(2,2-dibromoethenyl)-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | FC(F)(F)COc1ccc(C=C(Br)Br)cc1 |
| InChI | InChI=1S/C10H7Br2F3O/c11-9(12)5-7-1-3-8(4-2-7)16-6-10(13,14)15/h1-5H,6H2 |
| InChIKey | MMLZVGYIDWZCRE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.97 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |