C9H8Br2O — CID 10859278
1-(2,2-dibromoethenyl)-4-methoxybenzene (PubChem CID 10859278) has the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. Its IUPAC name is 1-(2,2-dibromoethenyl)-4-methoxybenzene.
| Compound Name | 1-(2,2-dibromoethenyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 10859278 |
| Molecular Formula | C9H8Br2O |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | 1-(2,2-dibromoethenyl)-4-methoxybenzene |
| SMILES | COc1ccc(C=C(Br)Br)cc1 |
| InChI | InChI=1S/C9H8Br2O/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-6H,1H3 |
| InChIKey | WPCVWFREMZVRMJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |