C22H19BrO2 — CID 66556000
1-[2,2-bis(4-methoxyphenyl)ethenyl]-4-bromobenzene (PubChem CID 66556000) has the molecular formula C22H19BrO2 and a molecular weight of 395.30 g/mol. Its IUPAC name is 1-[2,2-bis(4-methoxyphenyl)ethenyl]-4-bromobenzene.
| Compound Name | 1-[2,2-bis(4-methoxyphenyl)ethenyl]-4-bromobenzene |
|---|---|
| PubChem CID | 66556000 |
| Molecular Formula | C22H19BrO2 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[2,2-bis(4-methoxyphenyl)ethenyl]-4-bromobenzene |
| SMILES | COc1ccc(C(=Cc2ccc(Br)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H19BrO2/c1-24-20-11-5-17(6-12-20)22(15-16-3-9-19(23)10-4-16)18-7-13-21(25-2)14-8-18/h3-15H,1-2H3 |
| InChIKey | SUEIGYAMLCCWTK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|