C23H22O2 — CID 162409717
1-[2,2-bis(4-methoxyphenyl)ethenyl]-3-methylbenzene (PubChem CID 162409717) has the molecular formula C23H22O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[2,2-bis(4-methoxyphenyl)ethenyl]-3-methylbenzene.
| Compound Name | 1-[2,2-bis(4-methoxyphenyl)ethenyl]-3-methylbenzene |
|---|---|
| PubChem CID | 162409717 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[2,2-bis(4-methoxyphenyl)ethenyl]-3-methylbenzene |
| SMILES | COc1ccc(C(=Cc2cccc(C)c2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22O2/c1-17-5-4-6-18(15-17)16-23(19-7-11-21(24-2)12-8-19)20-9-13-22(25-3)14-10-20/h4-16H,1-3H3 |
| InChIKey | ZHQAFPRIUGAELT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|