C44H38O4 — CID 58991857
[4-[2-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-1-[4-(hydroxymethyl)phenyl]ethenyl]phenyl]methanol (PubChem CID 58991857) has the molecular formula C44H38O4 and a molecular weight of 630.78 g/mol. Its IUPAC name is [4-[2-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-1-[4-(hydroxymethyl)phenyl]ethenyl]phenyl]methanol.
| Compound Name | [4-[2-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-1-[4-(hydroxymethyl)phenyl]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 58991857 |
| Molecular Formula | C44H38O4 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | [4-[2-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-1-[4-(hydroxymethyl)phenyl]ethenyl]phenyl]methanol |
| SMILES | COc1ccc(C(=Cc2ccc(-c3ccc(C=C(c4ccc(CO)cc4)c4ccc(CO)cc4)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C44H38O4/c1-47-41-23-19-39(20-24-41)44(40-21-25-42(48-2)26-22-40)28-32-5-13-36(14-6-32)35-11-3-31(4-12-35)27-43(37-15-7-33(29-45)8-16-37)38-17-9-34(30-46)10-18-38/h3-28,45-46H,29-30H2,1-2H3 |
| InChIKey | QWQLLIVUWBDZJQ-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|