About cycloheptane;(4-methoxyphenyl)methanol
cycloheptane;(4-methoxyphenyl)methanol (PubChem CID 142801335) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is cycloheptane;(4-methoxyphenyl)methanol.
Molecular Properties
| Compound Name | cycloheptane;(4-methoxyphenyl)methanol |
| PubChem CID | 142801335 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | cycloheptane;(4-methoxyphenyl)methanol |
| SMILES | C1CCCCCC1.COc1ccc(CO)cc1 |
| InChI | InChI=1S/C8H10O2.C7H14/c1-10-8-4-2-7(6-9)3-5-8;1-2-4-6-7-5-3-1/h2-5,9H,6H2,1H3;1-7H2 |
| InChIKey | DQYYUWUMEWPJEG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cycloheptane;(4-methoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptane;(4-methoxyphenyl)methanol?
The IUPAC name of cycloheptane;(4-methoxyphenyl)methanol (CID 142801335) is cycloheptane;(4-methoxyphenyl)methanol.
What is the SMILES notation for cycloheptane;(4-methoxyphenyl)methanol?
The canonical SMILES for cycloheptane;(4-methoxyphenyl)methanol is C1CCCCCC1.COc1ccc(CO)cc1.
What is the InChIKey of cycloheptane;(4-methoxyphenyl)methanol?
The InChIKey is DQYYUWUMEWPJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C7H14/c1-10-8-4-2-7(6-9)3-5-8;1-2-4-6-7-5-3-1/h2-5,9H,6H2,1H3;1-7H2.
What are the key properties of cycloheptane;(4-methoxyphenyl)methanol?
cycloheptane;(4-methoxyphenyl)methanol has a molecular weight of 236.35 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptane;(4-methoxyphenyl)methanol is sourced from PubChem (CID 142801335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).