About anisole;[4-(chloromethyl)phenyl]methanol
anisole;[4-(chloromethyl)phenyl]methanol (PubChem CID 163893222) has the molecular formula C15H17ClO2
and a molecular weight of 264.75 g/mol. Its IUPAC name is anisole;[4-(chloromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | anisole;[4-(chloromethyl)phenyl]methanol |
| PubChem CID | 163893222 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | anisole;[4-(chloromethyl)phenyl]methanol |
| SMILES | COc1ccccc1.OCc1ccc(CCl)cc1 |
| InChI | InChI=1S/C8H9ClO.C7H8O/c9-5-7-1-3-8(6-10)4-2-7;1-8-7-5-3-2-4-6-7/h1-4,10H,5-6H2;2-6H,1H3 |
| InChIKey | QDJGGUSASNKCRM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze anisole;[4-(chloromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;[4-(chloromethyl)phenyl]methanol?
The IUPAC name of anisole;[4-(chloromethyl)phenyl]methanol (CID 163893222) is anisole;[4-(chloromethyl)phenyl]methanol.
What is the SMILES notation for anisole;[4-(chloromethyl)phenyl]methanol?
The canonical SMILES for anisole;[4-(chloromethyl)phenyl]methanol is COc1ccccc1.OCc1ccc(CCl)cc1.
What is the InChIKey of anisole;[4-(chloromethyl)phenyl]methanol?
The InChIKey is QDJGGUSASNKCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO.C7H8O/c9-5-7-1-3-8(6-10)4-2-7;1-8-7-5-3-2-4-6-7/h1-4,10H,5-6H2;2-6H,1H3.
What are the key properties of anisole;[4-(chloromethyl)phenyl]methanol?
anisole;[4-(chloromethyl)phenyl]methanol has a molecular weight of 264.75 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;[4-(chloromethyl)phenyl]methanol is sourced from PubChem (CID 163893222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).