About 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol
1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol (PubChem CID 158538625) has the molecular formula C20H29ClO4
and a molecular weight of 368.90 g/mol. Its IUPAC name is 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol.
Molecular Properties
| Compound Name | 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol |
| PubChem CID | 158538625 |
| Molecular Formula | C20H29ClO4 |
| Molecular Weight | 368.90 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol |
| SMILES | CCOCC.COc1ccc(CCl)cc1.COc1ccc(CO)cc1 |
| InChI | InChI=1S/C8H9ClO.C8H10O2.C4H10O/c2*1-10-8-4-2-7(6-9)3-5-8;1-3-5-4-2/h2-5H,6H2,1H3;2-5,9H,6H2,1H3;3-4H2,1-2H3 |
| InChIKey | HOGBKQFMSSMLSI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol?
The IUPAC name of 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol (CID 158538625) is 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol.
What is the SMILES notation for 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol?
The canonical SMILES for 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol is CCOCC.COc1ccc(CCl)cc1.COc1ccc(CO)cc1.
What is the InChIKey of 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol?
The InChIKey is HOGBKQFMSSMLSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO.C8H10O2.C4H10O/c2*1-10-8-4-2-7(6-9)3-5-8;1-3-5-4-2/h2-5H,6H2,1H3;2-5,9H,6H2,1H3;3-4H2,1-2H3.
What are the key properties of 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol?
1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol has a molecular weight of 368.90 g/mol, XLogP of 4.66, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-4-methoxybenzene;ethoxyethane;(4-methoxyphenyl)methanol is sourced from PubChem (CID 158538625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).