C26H23F3N2O5 — CID 175184030
[4-(2,2,2-trifluoroethoxy)phenyl] 4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]benzoate (PubChem CID 175184030) has the molecular formula C26H23F3N2O5 and a molecular weight of 500.47 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxy)phenyl] 4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]benzoate.
| Compound Name | [4-(2,2,2-trifluoroethoxy)phenyl] 4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 175184030 |
| Molecular Formula | C26H23F3N2O5 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxy)phenyl] 4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]benzoate |
| SMILES | CCOC(=O)C(=Cc1ccc(C(=O)Oc2ccc(OCC(F)(F)F)cc2)cc1)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C26H23F3N2O5/c1-2-34-25(33)23(18-12-19(30)14-20(31)13-18)11-16-3-5-17(6-4-16)24(32)36-22-9-7-21(8-10-22)35-15-26(27,28)29/h3-14H,2,15,30-31H2,1H3 |
| InChIKey | QKYFEVCOPZBBGD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|