C30H30F4N2O5 — CID 175176492
[4-[2-(3,5-diaminophenyl)-3-hexoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate (PubChem CID 175176492) has the molecular formula C30H30F4N2O5 and a molecular weight of 574.57 g/mol. Its IUPAC name is [4-[2-(3,5-diaminophenyl)-3-hexoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate.
| Compound Name | [4-[2-(3,5-diaminophenyl)-3-hexoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
|---|---|
| PubChem CID | 175176492 |
| Molecular Formula | C30H30F4N2O5 |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | [4-[2-(3,5-diaminophenyl)-3-hexoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
| SMILES | CCCCCCOC(=O)C(=Cc1ccc(OC(=O)c2ccc(OC(F)(F)C(F)F)cc2)cc1)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C30H30F4N2O5/c1-2-3-4-5-14-39-28(38)26(21-16-22(35)18-23(36)17-21)15-19-6-10-24(11-7-19)40-27(37)20-8-12-25(13-9-20)41-30(33,34)29(31)32/h6-13,15-18,29H,2-5,14,35-36H2,1H3 |
| InChIKey | LPONVPNWLJOTKG-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|