C25H20F4N2O5 — CID 76720969
[4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate (PubChem CID 76720969) has the molecular formula C25H20F4N2O5 and a molecular weight of 504.44 g/mol. Its IUPAC name is [4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate.
| Compound Name | [4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
|---|---|
| PubChem CID | 76720969 |
| Molecular Formula | C25H20F4N2O5 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | [4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
| SMILES | Nc1cc(N)cc(COC(=O)C=Cc2ccc(OC(=O)c3ccc(OC(F)(F)C(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C25H20F4N2O5/c26-24(27)25(28,29)36-21-8-4-17(5-9-21)23(33)35-20-6-1-15(2-7-20)3-10-22(32)34-14-16-11-18(30)13-19(31)12-16/h1-13,24H,14,30-31H2 |
| InChIKey | VYSVSGYBTYUCPG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|