C27H24F4N2O6 — CID 87260394
[4-[(E)-3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate (PubChem CID 87260394) has the molecular formula C27H24F4N2O6 and a molecular weight of 548.49 g/mol. Its IUPAC name is [4-[(E)-3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate.
| Compound Name | [4-[(E)-3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
|---|---|
| PubChem CID | 87260394 |
| Molecular Formula | C27H24F4N2O6 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | [4-[(E)-3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCc2cc(N)cc(N)c2)ccc1OC(=O)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C27H24F4N2O6/c1-36-23-14-16(3-9-24(34)37-11-10-17-12-19(32)15-20(33)13-17)2-8-22(23)38-25(35)18-4-6-21(7-5-18)39-27(30,31)26(28)29/h2-9,12-15,26H,10-11,32-33H2,1H3/b9-3+ |
| InChIKey | HWIYIECLLPVAMA-YCRREMRBSA-N |
| XLogP | 5.11 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|