C19H14F4O6 — CID 150325505
3-[3-methoxy-4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 150325505) has the molecular formula C19H14F4O6 and a molecular weight of 414.31 g/mol. Its IUPAC name is 3-[3-methoxy-4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-methoxy-4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 150325505 |
| Molecular Formula | C19H14F4O6 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3-[3-methoxy-4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)ccc1OC(=O)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C19H14F4O6/c1-27-15-10-11(3-9-16(24)25)2-8-14(15)28-17(26)12-4-6-13(7-5-12)29-19(22,23)18(20)21/h2-10,18H,1H3,(H,24,25) |
| InChIKey | GONYNDTWDMMTKD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|