C26H23F3N2O6 — CID 77222227
[4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate (PubChem CID 77222227) has the molecular formula C26H23F3N2O6 and a molecular weight of 516.47 g/mol. Its IUPAC name is [4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 77222227 |
| Molecular Formula | C26H23F3N2O6 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate |
| SMILES | COc1cc(C=CC(=O)OCCc2cc(N)cc(N)c2)ccc1OC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H23F3N2O6/c1-34-23-14-16(3-9-24(32)35-11-10-17-12-19(30)15-20(31)13-17)2-8-22(23)36-25(33)18-4-6-21(7-5-18)37-26(27,28)29/h2-9,12-15H,10-11,30-31H2,1H3 |
| InChIKey | YUTGRGUBPFSOIA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|