C25H21F3N2O5 — CID 91029086
[4-(trifluoromethoxy)phenyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 91029086) has the molecular formula C25H21F3N2O5 and a molecular weight of 486.45 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 91029086 |
| Molecular Formula | C25H21F3N2O5 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | Nc1ccc(N)c(CCOC(=O)C=Cc2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C25H21F3N2O5/c26-25(27,28)35-21-9-7-20(8-10-21)34-24(32)17-4-1-16(2-5-17)3-12-23(31)33-14-13-18-15-19(29)6-11-22(18)30/h1-12,15H,13-14,29-30H2 |
| InChIKey | HZTVIWQZCRNXMN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|