C28H26F4N2O5 — CID 77222393
[4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 3-fluoro-4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 77222393) has the molecular formula C28H26F4N2O5 and a molecular weight of 546.52 g/mol. Its IUPAC name is [4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 3-fluoro-4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 3-fluoro-4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 77222393 |
| Molecular Formula | C28H26F4N2O5 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | [4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 3-fluoro-4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | Nc1ccc(CCOC(=O)C=Cc2ccc(OC(=O)c3ccc(OCCCC(F)(F)F)c(F)c3)cc2)c(N)c1 |
| InChI | InChI=1S/C28H26F4N2O5/c29-23-16-20(6-10-25(23)37-14-1-13-28(30,31)32)27(36)39-22-8-2-18(3-9-22)4-11-26(35)38-15-12-19-5-7-21(33)17-24(19)34/h2-11,16-17H,1,12-15,33-34H2 |
| InChIKey | PHRQLDFHNTWHFC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|