C29H29F3N2O5 — CID 67078181
(2E)-5-(2,4-diaminophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid (PubChem CID 67078181) has the molecular formula C29H29F3N2O5 and a molecular weight of 542.55 g/mol. Its IUPAC name is (2E)-5-(2,4-diaminophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid.
| Compound Name | (2E)-5-(2,4-diaminophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid |
|---|---|
| PubChem CID | 67078181 |
| Molecular Formula | C29H29F3N2O5 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | (2E)-5-(2,4-diaminophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid |
| SMILES | Nc1ccc(CCC/C(=C\c2ccc(OC(=O)c3ccc(OCCCC(F)(F)F)cc3)cc2)C(=O)O)c(N)c1 |
| InChI | InChI=1S/C29H29F3N2O5/c30-29(31,32)15-2-16-38-24-13-8-21(9-14-24)28(37)39-25-11-5-19(6-12-25)17-22(27(35)36)4-1-3-20-7-10-23(33)18-26(20)34/h5-14,17-18H,1-4,15-16,33-34H2,(H,35,36)/b22-17+ |
| InChIKey | UZIQZSBGLGBYIJ-OQKWZONESA-N |
| XLogP | 6.28 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|