C25H21F3N2O5 — CID 66822956
(2E)-4-(3,5-diaminophenyl)-2-[[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid (PubChem CID 66822956) has the molecular formula C25H21F3N2O5 and a molecular weight of 486.45 g/mol. Its IUPAC name is (2E)-4-(3,5-diaminophenyl)-2-[[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid.
| Compound Name | (2E)-4-(3,5-diaminophenyl)-2-[[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 66822956 |
| Molecular Formula | C25H21F3N2O5 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (2E)-4-(3,5-diaminophenyl)-2-[[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid |
| SMILES | Nc1cc(N)cc(CC/C(=C\c2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C25H21F3N2O5/c26-25(27,28)35-22-9-7-21(8-10-22)34-24(33)17-4-1-15(2-5-17)11-18(23(31)32)6-3-16-12-19(29)14-20(30)13-16/h1-2,4-5,7-14H,3,6,29-30H2,(H,31,32)/b18-11+ |
| InChIKey | LIHXTUPUUICTMM-WOJGMQOQSA-N |
| XLogP | 5.07 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|