C29H27F5N2O5 — CID 173022218
4-(3,5-diaminophenyl)-2-[[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid (PubChem CID 173022218) has the molecular formula C29H27F5N2O5 and a molecular weight of 578.53 g/mol. Its IUPAC name is 4-(3,5-diaminophenyl)-2-[[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid.
| Compound Name | 4-(3,5-diaminophenyl)-2-[[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 173022218 |
| Molecular Formula | C29H27F5N2O5 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 4-(3,5-diaminophenyl)-2-[[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenoxy]carbonylphenyl]methylidene]butanoic acid |
| SMILES | Nc1cc(N)cc(CCC(=Cc2ccc(C(=O)Oc3ccc(OCCCC(F)(F)C(F)(F)F)cc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C29H27F5N2O5/c30-28(31,29(32,33)34)12-1-13-40-24-8-10-25(11-9-24)41-27(39)20-5-2-18(3-6-20)14-21(26(37)38)7-4-19-15-22(35)17-23(36)16-19/h2-3,5-6,8-11,14-17H,1,4,7,12-13,35-36H2,(H,37,38) |
| InChIKey | MQJJCWSVGNBMLR-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|