C30H29F5N2O6 — CID 87168505
(2E)-4-(2,4-diaminophenyl)-2-[[3-methoxy-4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]methylidene]butanoic acid (PubChem CID 87168505) has the molecular formula C30H29F5N2O6 and a molecular weight of 608.56 g/mol. Its IUPAC name is (2E)-4-(2,4-diaminophenyl)-2-[[3-methoxy-4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]methylidene]butanoic acid.
| Compound Name | (2E)-4-(2,4-diaminophenyl)-2-[[3-methoxy-4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 87168505 |
| Molecular Formula | C30H29F5N2O6 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | (2E)-4-(2,4-diaminophenyl)-2-[[3-methoxy-4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]methylidene]butanoic acid |
| SMILES | COc1cc(/C=C(\CCc2ccc(N)cc2N)C(=O)O)ccc1OC(=O)c1ccc(OCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H29F5N2O6/c1-41-26-16-18(15-21(27(38)39)5-4-19-6-9-22(36)17-24(19)37)3-12-25(26)43-28(40)20-7-10-23(11-8-20)42-14-2-13-29(31,32)30(33,34)35/h3,6-12,15-17H,2,4-5,13-14,36-37H2,1H3,(H,38,39)/b21-15+ |
| InChIKey | WYNQPEOTCUJFBK-RCCKNPSSSA-N |
| XLogP | 6.54 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|