C35H31F5N2O5 — CID 142696030
[4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(4,4,5,5,5-pentafluoropentoxy)benzoate (PubChem CID 142696030) has the molecular formula C35H31F5N2O5 and a molecular weight of 654.63 g/mol. Its IUPAC name is [4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(4,4,5,5,5-pentafluoropentoxy)benzoate.
| Compound Name | [4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
|---|---|
| PubChem CID | 142696030 |
| Molecular Formula | C35H31F5N2O5 |
| Molecular Weight | 654.63 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | [4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(/C=C/C(=O)c3c(N)ccc(-c4ccc(N)cc4)c3C)cc2)ccc1OCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H31F5N2O5/c1-21-27(23-7-10-25(41)11-8-23)14-15-28(42)32(21)29(43)16-6-22-4-12-26(13-5-22)47-33(44)24-9-17-30(31(20-24)45-2)46-19-3-18-34(36,37)35(38,39)40/h4-17,20H,3,18-19,41-42H2,1-2H3/b16-6+ |
| InChIKey | QINYXTHFUXMVTD-OMCISZLKSA-N |
| XLogP | 8.31 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.63 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|