C33H29F3N2O4 — CID 142696029
[4-(4,4,4-trifluorobutoxy)phenyl] 4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]benzoate (PubChem CID 142696029) has the molecular formula C33H29F3N2O4 and a molecular weight of 574.60 g/mol. Its IUPAC name is [4-(4,4,4-trifluorobutoxy)phenyl] 4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]benzoate.
| Compound Name | [4-(4,4,4-trifluorobutoxy)phenyl] 4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 142696029 |
| Molecular Formula | C33H29F3N2O4 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | [4-(4,4,4-trifluorobutoxy)phenyl] 4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]benzoate |
| SMILES | Cc1c(-c2ccc(N)cc2)ccc(N)c1C(=O)/C=C/c1ccc(C(=O)Oc2ccc(OCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H29F3N2O4/c1-21-28(23-8-10-25(37)11-9-23)16-17-29(38)31(21)30(39)18-5-22-3-6-24(7-4-22)32(40)42-27-14-12-26(13-15-27)41-20-2-19-33(34,35)36/h3-18H,2,19-20,37-38H2,1H3/b18-5+ |
| InChIKey | RHWHZFUEPNGMKT-BLLMUTORSA-N |
| XLogP | 7.66 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|