C32H27F3N2O5 — CID 142696039
[4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 142696039) has the molecular formula C32H27F3N2O5 and a molecular weight of 576.57 g/mol. Its IUPAC name is [4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | [4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 142696039 |
| Molecular Formula | C32H27F3N2O5 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | [4-[(E)-3-[6-amino-3-(4-aminophenyl)-2-methylphenyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | COc1cc(/C=C/C(=O)c2c(N)ccc(-c3ccc(N)cc3)c2C)ccc1OC(=O)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C32H27F3N2O5/c1-19-25(21-5-9-23(36)10-6-21)13-14-26(37)30(19)27(38)15-3-20-4-16-28(29(17-20)40-2)42-31(39)22-7-11-24(12-8-22)41-18-32(33,34)35/h3-17H,18,36-37H2,1-2H3/b15-3+ |
| InChIKey | XZINQYGFUQYJOH-CRKCGEKBSA-N |
| XLogP | 6.89 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|