C18H15F3O2 — CID 132555327
(E)-3-(4-methylphenyl)-1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-en-1-one (PubChem CID 132555327) has the molecular formula C18H15F3O2 and a molecular weight of 320.31 g/mol. Its IUPAC name is (E)-3-(4-methylphenyl)-1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-methylphenyl)-1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 132555327 |
| Molecular Formula | C18H15F3O2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (E)-3-(4-methylphenyl)-1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)c2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H15F3O2/c1-13-2-4-14(5-3-13)6-11-17(22)15-7-9-16(10-8-15)23-12-18(19,20)21/h2-11H,12H2,1H3/b11-6+ |
| InChIKey | CKYVENOGLVYOIX-IZZDOVSWSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|