C23H25F3O2 — CID 129017227
(E)-3-(4-tert-butylphenyl)-1-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-en-1-one (PubChem CID 129017227) has the molecular formula C23H25F3O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-1-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-tert-butylphenyl)-1-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129017227 |
| Molecular Formula | C23H25F3O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-1-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H25F3O2/c1-22(2,3)19-10-5-17(6-11-19)7-14-21(27)18-8-12-20(13-9-18)28-16-4-15-23(24,25)26/h5-14H,4,15-16H2,1-3H3/b14-7+ |
| InChIKey | SMDDGXJNHGHCIB-VGOFMYFVSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|