C18H12F3NO2 — CID 60593947
4-[(E)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoyl]benzonitrile (PubChem CID 60593947) has the molecular formula C18H12F3NO2 and a molecular weight of 331.29 g/mol. Its IUPAC name is 4-[(E)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoyl]benzonitrile.
| Compound Name | 4-[(E)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoyl]benzonitrile |
|---|---|
| PubChem CID | 60593947 |
| Molecular Formula | C18H12F3NO2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-[(E)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)/C=C/c2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H12F3NO2/c19-18(20,21)12-24-16-8-3-13(4-9-16)5-10-17(23)15-6-1-14(11-22)2-7-15/h1-10H,12H2/b10-5+ |
| InChIKey | QPQREOWYKRVCLK-BJMVGYQFSA-N |
| XLogP | 4.40 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|