C30H31F3N2O6 — CID 175178360
[4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(5,5,5-trifluoropentoxy)benzoate (PubChem CID 175178360) has the molecular formula C30H31F3N2O6 and a molecular weight of 572.58 g/mol. Its IUPAC name is [4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(5,5,5-trifluoropentoxy)benzoate.
| Compound Name | [4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(5,5,5-trifluoropentoxy)benzoate |
|---|---|
| PubChem CID | 175178360 |
| Molecular Formula | C30H31F3N2O6 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | [4-[2-(3,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(5,5,5-trifluoropentoxy)benzoate |
| SMILES | CCOC(=O)C(=Cc1ccc(OC(=O)c2ccc(OCCCCC(F)(F)F)c(OC)c2)cc1)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C30H31F3N2O6/c1-3-39-29(37)25(21-15-22(34)18-23(35)16-21)14-19-6-9-24(10-7-19)41-28(36)20-8-11-26(27(17-20)38-2)40-13-5-4-12-30(31,32)33/h6-11,14-18H,3-5,12-13,34-35H2,1-2H3 |
| InChIKey | FXAIPSWYKZCLFX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|