C27H25F3N2O6 — CID 175181208
[4-[2-(2,4-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 175181208) has the molecular formula C27H25F3N2O6 and a molecular weight of 530.50 g/mol. Its IUPAC name is [4-[2-(2,4-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | [4-[2-(2,4-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 175181208 |
| Molecular Formula | C27H25F3N2O6 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [4-[2-(2,4-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 3-methoxy-4-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | CCOC(=O)C(=Cc1ccc(OC(=O)c2ccc(OCC(F)(F)F)c(OC)c2)cc1)c1ccc(N)cc1N |
| InChI | InChI=1S/C27H25F3N2O6/c1-3-36-26(34)21(20-10-7-18(31)14-22(20)32)12-16-4-8-19(9-5-16)38-25(33)17-6-11-23(24(13-17)35-2)37-15-27(28,29)30/h4-14H,3,15,31-32H2,1-2H3 |
| InChIKey | RMIJOIVJCLWCTC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|