C29H26F3N3O5 — CID 123151835
[4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)-3-(trifluoromethyl)benzoate (PubChem CID 123151835) has the molecular formula C29H26F3N3O5 and a molecular weight of 553.54 g/mol. Its IUPAC name is [4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)-3-(trifluoromethyl)benzoate.
| Compound Name | [4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 123151835 |
| Molecular Formula | C29H26F3N3O5 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | [4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)-3-(trifluoromethyl)benzoate |
| SMILES | N#CCCCOc1ccc(C(=O)Oc2ccc(C=CC(=O)OCCc3ccc(N)cc3N)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C29H26F3N3O5/c30-29(31,32)24-17-21(7-11-26(24)38-15-2-1-14-33)28(37)40-23-9-3-19(4-10-23)5-12-27(36)39-16-13-20-6-8-22(34)18-25(20)35/h3-12,17-18H,1-2,13,15-16,34-35H2 |
| InChIKey | BFVRKSIUXIJWSO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|