C19H17FO6 — CID 140939823
(E)-3-[4-[3-fluoro-4-(2-methoxyethoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 140939823) has the molecular formula C19H17FO6 and a molecular weight of 360.34 g/mol. Its IUPAC name is (E)-3-[4-[3-fluoro-4-(2-methoxyethoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-fluoro-4-(2-methoxyethoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 140939823 |
| Molecular Formula | C19H17FO6 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (E)-3-[4-[3-fluoro-4-(2-methoxyethoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | COCCOc1ccc(C(=O)Oc2ccc(/C=C/C(=O)O)cc2)cc1F |
| InChI | InChI=1S/C19H17FO6/c1-24-10-11-25-17-8-5-14(12-16(17)20)19(23)26-15-6-2-13(3-7-15)4-9-18(21)22/h2-9,12H,10-11H2,1H3,(H,21,22)/b9-4+ |
| InChIKey | WSMWBNVETLTZCK-RUDMXATFSA-N |
| XLogP | 3.17 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|