C21H20F2O5 — CID 77274188
3-[4-(2,3-difluoro-4-pentoxybenzoyl)oxyphenyl]prop-2-enoic acid (PubChem CID 77274188) has the molecular formula C21H20F2O5 and a molecular weight of 390.38 g/mol. Its IUPAC name is 3-[4-(2,3-difluoro-4-pentoxybenzoyl)oxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2,3-difluoro-4-pentoxybenzoyl)oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77274188 |
| Molecular Formula | C21H20F2O5 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-[4-(2,3-difluoro-4-pentoxybenzoyl)oxyphenyl]prop-2-enoic acid |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(C=CC(=O)O)cc2)c(F)c1F |
| InChI | InChI=1S/C21H20F2O5/c1-2-3-4-13-27-17-11-10-16(19(22)20(17)23)21(26)28-15-8-5-14(6-9-15)7-12-18(24)25/h5-12H,2-4,13H2,1H3,(H,24,25) |
| InChIKey | MGYFDQYNUBIFIW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|