C48H34F6N2O8 — CID 175176633
[4-(trifluoromethoxy)phenyl] 4-[(E)-4-[5-amino-2-[4-amino-2-[(E)-2-oxo-4-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]but-3-enyl]phenyl]phenyl]-3-oxobut-1-enyl]benzoate (PubChem CID 175176633) has the molecular formula C48H34F6N2O8 and a molecular weight of 880.79 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[(E)-4-[5-amino-2-[4-amino-2-[(E)-2-oxo-4-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]but-3-enyl]phenyl]phenyl]-3-oxobut-1-enyl]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[(E)-4-[5-amino-2-[4-amino-2-[(E)-2-oxo-4-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]but-3-enyl]phenyl]phenyl]-3-oxobut-1-enyl]benzoate |
|---|---|
| PubChem CID | 175176633 |
| Molecular Formula | C48H34F6N2O8 |
| Molecular Weight | 880.79 g/mol |
| Exact Mass | 880.22 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[(E)-4-[5-amino-2-[4-amino-2-[(E)-2-oxo-4-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]but-3-enyl]phenyl]phenyl]-3-oxobut-1-enyl]benzoate |
| SMILES | Nc1ccc(-c2ccc(N)cc2CC(=O)/C=C/c2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)c(CC(=O)/C=C/c2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C48H34F6N2O8/c49-47(50,51)63-41-19-15-39(16-20-41)61-45(59)31-7-1-29(2-8-31)5-13-37(57)27-33-25-35(55)11-23-43(33)44-24-12-36(56)26-34(44)28-38(58)14-6-30-3-9-32(10-4-30)46(60)62-40-17-21-42(22-18-40)64-48(52,53)54/h1-26H,27-28,55-56H2/b13-5+,14-6+ |
| InChIKey | KEUXPMGUCJTIOB-ACFHMISVSA-N |
| XLogP | 10.40 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.79 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|