C11H12F3IO2 — CID 119093818
1-(3-iodopropoxy)-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 119093818) has the molecular formula C11H12F3IO2 and a molecular weight of 360.11 g/mol. Its IUPAC name is 1-(3-iodopropoxy)-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-(3-iodopropoxy)-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 119093818 |
| Molecular Formula | C11H12F3IO2 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 1-(3-iodopropoxy)-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | FC(F)(F)COc1ccc(OCCCI)cc1 |
| InChI | InChI=1S/C11H12F3IO2/c12-11(13,14)8-17-10-4-2-9(3-5-10)16-7-1-6-15/h2-5H,1,6-8H2 |
| InChIKey | BAUZSHLVRDMBPX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|