C15H21F3O2 — CID 64765867
1-tert-butyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene (PubChem CID 64765867) has the molecular formula C15H21F3O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-tert-butyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene.
| Compound Name | 1-tert-butyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
|---|---|
| PubChem CID | 64765867 |
| Molecular Formula | C15H21F3O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-tert-butyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
| SMILES | CC(C)(C)c1ccc(OCCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3O2/c1-14(2,3)12-5-7-13(8-6-12)20-10-4-9-19-11-15(16,17)18/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | IQVOXEWKDZATDB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|