C11H13BF4O4 — CID 65203771
[2-fluoro-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]boronic acid (PubChem CID 65203771) has the molecular formula C11H13BF4O4 and a molecular weight of 296.02 g/mol. Its IUPAC name is [2-fluoro-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]boronic acid.
| Compound Name | [2-fluoro-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 65203771 |
| Molecular Formula | C11H13BF4O4 |
| Molecular Weight | 296.02 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [2-fluoro-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(OCCCOCC(F)(F)F)cc1F |
| InChI | InChI=1S/C11H13BF4O4/c13-10-6-8(2-3-9(10)12(17)18)20-5-1-4-19-7-11(14,15)16/h2-3,6,17-18H,1,4-5,7H2 |
| InChIKey | VLYCYUFLGNPOOP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.02 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|