C12H18BFO5S — CID 106726786
[4-(2-tert-butylsulfonylethoxy)-2-fluorophenyl]boronic acid (PubChem CID 106726786) has the molecular formula C12H18BFO5S and a molecular weight of 304.15 g/mol. Its IUPAC name is [4-(2-tert-butylsulfonylethoxy)-2-fluorophenyl]boronic acid.
| Compound Name | [4-(2-tert-butylsulfonylethoxy)-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 106726786 |
| Molecular Formula | C12H18BFO5S |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [4-(2-tert-butylsulfonylethoxy)-2-fluorophenyl]boronic acid |
| SMILES | CC(C)(C)S(=O)(=O)CCOc1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C12H18BFO5S/c1-12(2,3)20(17,18)7-6-19-9-4-5-10(13(15)16)11(14)8-9/h4-5,8,15-16H,6-7H2,1-3H3 |
| InChIKey | LFUKNHDVSQJYOC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|