C13H18FNO3S2 — CID 106724915
4-(2-tert-butylsulfonylethoxy)-2-fluorobenzenecarbothioamide (PubChem CID 106724915) has the molecular formula C13H18FNO3S2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 4-(2-tert-butylsulfonylethoxy)-2-fluorobenzenecarbothioamide.
| Compound Name | 4-(2-tert-butylsulfonylethoxy)-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106724915 |
| Molecular Formula | C13H18FNO3S2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-(2-tert-butylsulfonylethoxy)-2-fluorobenzenecarbothioamide |
| SMILES | CC(C)(C)S(=O)(=O)CCOc1ccc(C(N)=S)c(F)c1 |
| InChI | InChI=1S/C13H18FNO3S2/c1-13(2,3)20(16,17)7-6-18-9-4-5-10(12(15)19)11(14)8-9/h4-5,8H,6-7H2,1-3H3,(H2,15,19) |
| InChIKey | VGJNKAICQHNRLC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|