C13H19FO4S — CID 107690715
[4-(2-tert-butylsulfonylethoxy)-3-fluorophenyl]methanol (PubChem CID 107690715) has the molecular formula C13H19FO4S and a molecular weight of 290.36 g/mol. Its IUPAC name is [4-(2-tert-butylsulfonylethoxy)-3-fluorophenyl]methanol.
| Compound Name | [4-(2-tert-butylsulfonylethoxy)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 107690715 |
| Molecular Formula | C13H19FO4S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [4-(2-tert-butylsulfonylethoxy)-3-fluorophenyl]methanol |
| SMILES | CC(C)(C)S(=O)(=O)CCOc1ccc(CO)cc1F |
| InChI | InChI=1S/C13H19FO4S/c1-13(2,3)19(16,17)7-6-18-12-5-4-10(9-15)8-11(12)14/h4-5,8,15H,6-7,9H2,1-3H3 |
| InChIKey | GGYHJSYAPLJHGQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |