C15H21FO2 — CID 114191393
[4-(2-cyclohexylethoxy)-3-fluorophenyl]methanol (PubChem CID 114191393) has the molecular formula C15H21FO2 and a molecular weight of 252.33 g/mol. Its IUPAC name is [4-(2-cyclohexylethoxy)-3-fluorophenyl]methanol.
| Compound Name | [4-(2-cyclohexylethoxy)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 114191393 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | [4-(2-cyclohexylethoxy)-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(OCCC2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C15H21FO2/c16-14-10-13(11-17)6-7-15(14)18-9-8-12-4-2-1-3-5-12/h6-7,10,12,17H,1-5,8-9,11H2 |
| InChIKey | YOTIWVSWGWFIOF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |