C14H18F2O — CID 114276820
1-(2-cyclopentylethoxy)-4,5-difluoro-2-methylbenzene (PubChem CID 114276820) has the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-(2-cyclopentylethoxy)-4,5-difluoro-2-methylbenzene.
| Compound Name | 1-(2-cyclopentylethoxy)-4,5-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 114276820 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(2-cyclopentylethoxy)-4,5-difluoro-2-methylbenzene |
| SMILES | Cc1cc(F)c(F)cc1OCCC1CCCC1 |
| InChI | InChI=1S/C14H18F2O/c1-10-8-12(15)13(16)9-14(10)17-7-6-11-4-2-3-5-11/h8-9,11H,2-7H2,1H3 |
| InChIKey | RUHYOFQOCFPBFZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |