C14H17F3O2 — CID 63320664
[4-(cyclopentylmethoxy)-3-(trifluoromethyl)phenyl]methanol (PubChem CID 63320664) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is [4-(cyclopentylmethoxy)-3-(trifluoromethyl)phenyl]methanol.
| Compound Name | [4-(cyclopentylmethoxy)-3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 63320664 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [4-(cyclopentylmethoxy)-3-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1ccc(OCC2CCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3O2/c15-14(16,17)12-7-11(8-18)5-6-13(12)19-9-10-3-1-2-4-10/h5-7,10,18H,1-4,8-9H2 |
| InChIKey | GQERAMFYDPLDRI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |