C15H19ClF3NOS — CID 168879276
4-[[4-(chloromethyl)-2-(trifluoromethyl)phenoxy]methyl]-1-methylsulfanylpiperidine (PubChem CID 168879276) has the molecular formula C15H19ClF3NOS and a molecular weight of 353.84 g/mol. Its IUPAC name is 4-[[4-(chloromethyl)-2-(trifluoromethyl)phenoxy]methyl]-1-methylsulfanylpiperidine.
| Compound Name | 4-[[4-(chloromethyl)-2-(trifluoromethyl)phenoxy]methyl]-1-methylsulfanylpiperidine |
|---|---|
| PubChem CID | 168879276 |
| Molecular Formula | C15H19ClF3NOS |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 4-[[4-(chloromethyl)-2-(trifluoromethyl)phenoxy]methyl]-1-methylsulfanylpiperidine |
| SMILES | CSN1CCC(COc2ccc(CCl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H19ClF3NOS/c1-22-20-6-4-11(5-7-20)10-21-14-3-2-12(9-16)8-13(14)15(17,18)19/h2-3,8,11H,4-7,9-10H2,1H3 |
| InChIKey | XYFQGUSZJVLNOZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|