C12H13F3O2 — CID 166611039
4-(cyclobutylmethoxy)-3-(trifluoromethyl)phenol (PubChem CID 166611039) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-(cyclobutylmethoxy)-3-(trifluoromethyl)phenol.
| Compound Name | 4-(cyclobutylmethoxy)-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 166611039 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-(cyclobutylmethoxy)-3-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(OCC2CCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3O2/c13-12(14,15)10-6-9(16)4-5-11(10)17-7-8-2-1-3-8/h4-6,8,16H,1-3,7H2 |
| InChIKey | LCIRUYPJAIILOG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |